C12H24N2 — CID 172567560
(2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine (PubChem CID 172567560) has the molecular formula C12H24N2 and a molecular weight of 196.34 g/mol. Its IUPAC name is (2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine.
| Compound Name | (2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine |
|---|---|
| PubChem CID | 172567560 |
| Molecular Formula | C12H24N2 |
| Molecular Weight | 196.34 g/mol |
| Exact Mass | 196.19 |
| IUPAC Name | (2E)-N-ethyl-2-ethylidene-3-imino-N-methylheptan-1-amine |
| SMILES | [H]/N=C(CCCC)/C(=C/C)CN(C)CC |
| InChI | InChI=1S/C12H24N2/c1-5-8-9-12(13)11(6-2)10-14(4)7-3/h6,13H,5,7-10H2,1-4H3/b11-6+,13-12+ |
| InChIKey | JEFROPFRYARJIX-BPLLCVTGSA-N |
| XLogP | 3.09 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|