C18H28N2O3S — CID 17256766
N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-2-methylbutanamide (PubChem CID 17256766) has the molecular formula C18H28N2O3S and a molecular weight of 352.50 g/mol. Its IUPAC name is N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-2-methylbutanamide.
| Compound Name | N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-2-methylbutanamide |
|---|---|
| PubChem CID | 17256766 |
| Molecular Formula | C18H28N2O3S |
| Molecular Weight | 352.50 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | N-[4-(2-ethylpiperidin-1-yl)sulfonylphenyl]-2-methylbutanamide |
| SMILES | CCC(C)C(=O)Nc1ccc(S(=O)(=O)N2CCCCC2CC)cc1 |
| InChI | InChI=1S/C18H28N2O3S/c1-4-14(3)18(21)19-15-9-11-17(12-10-15)24(22,23)20-13-7-6-8-16(20)5-2/h9-12,14,16H,4-8,13H2,1-3H3,(H,19,21) |
| InChIKey | LDKLTHGYGKRPIT-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.50 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |