About (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one
(4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one (PubChem CID 172567855) has the molecular formula C15H15F3N2O2S
and a molecular weight of 344.36 g/mol. Its IUPAC name is (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one |
| PubChem CID | 172567855 |
| Molecular Formula | C15H15F3N2O2S |
| Molecular Weight | 344.36 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(C(F)(F)F)/C1=C/c1ccc(N2CCCCCC2)s1 |
| InChI | InChI=1S/C15H15F3N2O2S/c16-15(17,18)13-11(14(21)22-19-13)9-10-5-6-12(23-10)20-7-3-1-2-4-8-20/h5-6,9H,1-4,7-8H2/b11-9- |
| InChIKey | AILKBNLHGDRFRX-LUAWRHEFSA-N |
| XLogP | 3.99 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.36 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
The IUPAC name of (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one (CID 172567855) is (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one.
What is the SMILES notation for (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
The canonical SMILES for (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one is O=C1ON=C(C(F)(F)F)/C1=C/c1ccc(N2CCCCCC2)s1.
What is the InChIKey of (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
The InChIKey is AILKBNLHGDRFRX-LUAWRHEFSA-N. The full InChI is InChI=1S/C15H15F3N2O2S/c16-15(17,18)13-11(14(21)22-19-13)9-10-5-6-12(23-10)20-7-3-1-2-4-8-20/h5-6,9H,1-4,7-8H2/b11-9-.
What are the key properties of (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
(4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one has a molecular weight of 344.36 g/mol, XLogP of 3.99, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[[5-(azepan-1-yl)thiophen-2-yl]methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one is sourced from PubChem (CID 172567855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).