C12H9F5N2O2S — CID 172567858
(4E)-4-[[5-(dimethylamino)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one (PubChem CID 172567858) has the molecular formula C12H9F5N2O2S and a molecular weight of 340.27 g/mol. Its IUPAC name is (4E)-4-[[5-(dimethylamino)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one.
| Compound Name | (4E)-4-[[5-(dimethylamino)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 172567858 |
| Molecular Formula | C12H9F5N2O2S |
| Molecular Weight | 340.27 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | (4E)-4-[[5-(dimethylamino)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one |
| SMILES | CN(C)c1ccc(/C=C2/C(=O)ON=C2C(F)(F)C(F)(F)F)s1 |
| InChI | InChI=1S/C12H9F5N2O2S/c1-19(2)8-4-3-6(22-8)5-7-9(18-21-10(7)20)11(13,14)12(15,16)17/h3-5H,1-2H3/b7-5+ |
| InChIKey | ZJCBKAOPQMKZFV-FNORWQNLSA-N |
| XLogP | 3.31 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.27 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|