C15H9F3N4O2S — CID 172567859
(3R,4S)-1-[5-[(Z)-[5-oxo-3-(trifluoromethyl)-1,2-oxazol-4-ylidene]methyl]thiophen-2-yl]pyrrolidine-3,4-dicarbonitrile (PubChem CID 172567859) has the molecular formula C15H9F3N4O2S and a molecular weight of 366.32 g/mol. Its IUPAC name is (3R,4S)-1-[5-[(Z)-[5-oxo-3-(trifluoromethyl)-1,2-oxazol-4-ylidene]methyl]thiophen-2-yl]pyrrolidine-3,4-dicarbonitrile.
| Compound Name | (3R,4S)-1-[5-[(Z)-[5-oxo-3-(trifluoromethyl)-1,2-oxazol-4-ylidene]methyl]thiophen-2-yl]pyrrolidine-3,4-dicarbonitrile |
|---|---|
| PubChem CID | 172567859 |
| Molecular Formula | C15H9F3N4O2S |
| Molecular Weight | 366.32 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (3R,4S)-1-[5-[(Z)-[5-oxo-3-(trifluoromethyl)-1,2-oxazol-4-ylidene]methyl]thiophen-2-yl]pyrrolidine-3,4-dicarbonitrile |
| SMILES | N#C[C@@H]1CN(c2ccc(/C=C3\C(=O)ON=C3C(F)(F)F)s2)C[C@@H]1C#N |
| InChI | InChI=1S/C15H9F3N4O2S/c16-15(17,18)13-11(14(23)24-21-13)3-10-1-2-12(25-10)22-6-8(4-19)9(5-20)7-22/h1-3,8-9H,6-7H2/b11-3-/t8-,9+ |
| InChIKey | IVRNTUPQZNQADN-BRAAFETOSA-N |
| XLogP | 2.71 |
| TPSA | 89.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.32 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|