C14H11F5N2O3S2 — CID 172567864
4-[[5-(1-oxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one (PubChem CID 172567864) has the molecular formula C14H11F5N2O3S2 and a molecular weight of 414.38 g/mol. Its IUPAC name is 4-[[5-(1-oxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one.
| Compound Name | 4-[[5-(1-oxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 172567864 |
| Molecular Formula | C14H11F5N2O3S2 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | 4-[[5-(1-oxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-3-(1,1,2,2,2-pentafluoroethyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(C(F)(F)C(F)(F)F)C1=Cc1ccc(N2CCS(=O)CC2)s1 |
| InChI | InChI=1S/C14H11F5N2O3S2/c15-13(16,14(17,18)19)11-9(12(22)24-20-11)7-8-1-2-10(25-8)21-3-5-26(23)6-4-21/h1-2,7H,3-6H2 |
| InChIKey | UMTAFTGISWOMSZ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 58.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|