C13H12F2N2O4S2 — CID 172567877
(4Z)-3-(difluoromethyl)-4-[[5-(1,1-dioxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-1,2-oxazol-5-one (PubChem CID 172567877) has the molecular formula C13H12F2N2O4S2 and a molecular weight of 362.38 g/mol. Its IUPAC name is (4Z)-3-(difluoromethyl)-4-[[5-(1,1-dioxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-1,2-oxazol-5-one.
| Compound Name | (4Z)-3-(difluoromethyl)-4-[[5-(1,1-dioxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-1,2-oxazol-5-one |
|---|---|
| PubChem CID | 172567877 |
| Molecular Formula | C13H12F2N2O4S2 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.02 |
| IUPAC Name | (4Z)-3-(difluoromethyl)-4-[[5-(1,1-dioxo-1,4-thiazinan-4-yl)thiophen-2-yl]methylidene]-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(C(F)F)/C1=C/c1ccc(N2CCS(=O)(=O)CC2)s1 |
| InChI | InChI=1S/C13H12F2N2O4S2/c14-12(15)11-9(13(18)21-16-11)7-8-1-2-10(22-8)17-3-5-23(19,20)6-4-17/h1-2,7,12H,3-6H2/b9-7- |
| InChIKey | VIXSQHLRYYUNCX-CLFYSBASSA-N |
| XLogP | 1.54 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|