About (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one
(4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one (PubChem CID 172568029) has the molecular formula C13H11F3N2O3S
and a molecular weight of 332.30 g/mol. Its IUPAC name is (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one.
Molecular Properties
| Compound Name | (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one |
| PubChem CID | 172568029 |
| Molecular Formula | C13H11F3N2O3S |
| Molecular Weight | 332.30 g/mol |
| Exact Mass | 332.04 |
| IUPAC Name | (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one |
| SMILES | O=C1ON=C(C(F)(F)F)/C1=C/c1ccc(N2CCOCC2)s1 |
| InChI | InChI=1S/C13H11F3N2O3S/c14-13(15,16)11-9(12(19)21-17-11)7-8-1-2-10(22-8)18-3-5-20-6-4-18/h1-2,7H,3-6H2/b9-7- |
| InChIKey | UOXOPOXZYWZADA-CLFYSBASSA-N |
| XLogP | 2.44 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.30 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'} |
|---|
Analyze (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
The IUPAC name of (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one (CID 172568029) is (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one.
What is the SMILES notation for (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
The canonical SMILES for (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one is O=C1ON=C(C(F)(F)F)/C1=C/c1ccc(N2CCOCC2)s1.
What is the InChIKey of (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
The InChIKey is UOXOPOXZYWZADA-CLFYSBASSA-N. The full InChI is InChI=1S/C13H11F3N2O3S/c14-13(15,16)11-9(12(19)21-17-11)7-8-1-2-10(22-8)18-3-5-20-6-4-18/h1-2,7H,3-6H2/b9-7-.
What are the key properties of (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one?
(4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one has a molecular weight of 332.30 g/mol, XLogP of 2.44, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (4Z)-4-[(5-morpholin-4-ylthiophen-2-yl)methylidene]-3-(trifluoromethyl)-1,2-oxazol-5-one is sourced from PubChem (CID 172568029), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).