C20H32S — CID 172568185
methanethiol;11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene (PubChem CID 172568185) has the molecular formula C20H32S and a molecular weight of 304.54 g/mol. Its IUPAC name is methanethiol;11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene.
| Compound Name | methanethiol;11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene |
|---|---|
| PubChem CID | 172568185 |
| Molecular Formula | C20H32S |
| Molecular Weight | 304.54 g/mol |
| Exact Mass | 304.22 |
| IUPAC Name | methanethiol;11-methylpentacyclo[8.8.0.02,7.05,7.011,16]octadec-16-ene |
| SMILES | CC12CCCCC1=CCC1C2CCC23CC2CCC13.CS |
| InChI | InChI=1S/C19H28.CH4S/c1-18-10-3-2-4-13(18)5-7-15-16(18)9-11-19-12-14(19)6-8-17(15)19;1-2/h5,14-17H,2-4,6-12H2,1H3;2H,1H3 |
| InChIKey | IKXQZUUVCMJYSB-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.54 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|