C26H36ClN3O4 — CID 172568240
tert-butyl 2-[14-chloro-2-(2-methylpropyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-5-yl]acetate;ethane (PubChem CID 172568240) has the molecular formula C26H36ClN3O4 and a molecular weight of 490.04 g/mol. Its IUPAC name is tert-butyl 2-[14-chloro-2-(2-methylpropyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-5-yl]acetate;ethane.
| Compound Name | tert-butyl 2-[14-chloro-2-(2-methylpropyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-5-yl]acetate;ethane |
|---|---|
| PubChem CID | 172568240 |
| Molecular Formula | C26H36ClN3O4 |
| Molecular Weight | 490.04 g/mol |
| Exact Mass | 489.24 |
| IUPAC Name | tert-butyl 2-[14-chloro-2-(2-methylpropyl)-4,7-dioxo-3,6,17-triazatetracyclo[8.7.0.03,8.011,16]heptadeca-1(10),11,13,15-tetraen-5-yl]acetate;ethane |
| SMILES | CC.CC(C)CC1c2[nH]c3cc(Cl)ccc3c2CC2C(=O)NC(CC(=O)OC(C)(C)C)C(=O)N21 |
| InChI | InChI=1S/C24H30ClN3O4.C2H6/c1-12(2)8-18-21-15(14-7-6-13(25)9-16(14)26-21)10-19-22(30)27-17(23(31)28(18)19)11-20(29)32-24(3,4)5;1-2/h6-7,9,12,17-19,26H,8,10-11H2,1-5H3,(H,27,30);1-2H3 |
| InChIKey | DYTSVDYJLDCDTQ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.04 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|