C24H27ClN4O4 — CID 172568762
4-[5-chloro-2-(3,6-dihydro-2H-pyran-5-yl)-3-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-b]pyridin-7-yl]morpholine (PubChem CID 172568762) has the molecular formula C24H27ClN4O4 and a molecular weight of 470.96 g/mol. Its IUPAC name is 4-[5-chloro-2-(3,6-dihydro-2H-pyran-5-yl)-3-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-b]pyridin-7-yl]morpholine.
| Compound Name | 4-[5-chloro-2-(3,6-dihydro-2H-pyran-5-yl)-3-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-b]pyridin-7-yl]morpholine |
|---|---|
| PubChem CID | 172568762 |
| Molecular Formula | C24H27ClN4O4 |
| Molecular Weight | 470.96 g/mol |
| Exact Mass | 470.17 |
| IUPAC Name | 4-[5-chloro-2-(3,6-dihydro-2H-pyran-5-yl)-3-[(2,4-dimethoxyphenyl)methyl]imidazo[4,5-b]pyridin-7-yl]morpholine |
| SMILES | COc1ccc(Cn2c(C3=CCCOC3)nc3c(N4CCOCC4)cc(Cl)nc32)c(OC)c1 |
| InChI | InChI=1S/C24H27ClN4O4/c1-30-18-6-5-16(20(12-18)31-2)14-29-23(17-4-3-9-33-15-17)27-22-19(13-21(25)26-24(22)29)28-7-10-32-11-8-28/h4-6,12-13H,3,7-11,14-15H2,1-2H3 |
| InChIKey | LMLXLPCSIFKWSJ-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.87 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.96 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|