C26H29FN8S2 — CID 172569747
4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine (PubChem CID 172569747) has the molecular formula C26H29FN8S2 and a molecular weight of 536.71 g/mol. Its IUPAC name is 4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine.
| Compound Name | 4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 172569747 |
| Molecular Formula | C26H29FN8S2 |
| Molecular Weight | 536.71 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 4-[4-[2-fluoro-3-(propylsulfanylamino)phenyl]-2-methyl-1,3-thiazol-5-yl]-N-(5-piperazin-1-yl-2-pyridinyl)pyrimidin-2-amine |
| SMILES | CCCSNc1cccc(-c2nc(C)sc2-c2ccnc(Nc3ccc(N4CCNCC4)cn3)n2)c1F |
| InChI | InChI=1S/C26H29FN8S2/c1-3-15-36-34-20-6-4-5-19(23(20)27)24-25(37-17(2)31-24)21-9-10-29-26(32-21)33-22-8-7-18(16-30-22)35-13-11-28-12-14-35/h4-10,16,28,34H,3,11-15H2,1-2H3,(H,29,30,32,33) |
| InChIKey | WMNZSNPPEFFFMK-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 90.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.71 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|