C28H35FN8S2 — CID 172569804
4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-amine (PubChem CID 172569804) has the molecular formula C28H35FN8S2 and a molecular weight of 566.78 g/mol. Its IUPAC name is 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-amine.
| Compound Name | 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 172569804 |
| Molecular Formula | C28H35FN8S2 |
| Molecular Weight | 566.78 g/mol |
| Exact Mass | 566.24 |
| IUPAC Name | 4-[2-tert-butyl-4-[2-fluoro-3-(propylsulfanylamino)phenyl]-1,3-thiazol-5-yl]-N-(1-piperidin-4-ylpyrazol-4-yl)pyrimidin-2-amine |
| SMILES | CCCSNc1cccc(-c2nc(C(C)(C)C)sc2-c2ccnc(Nc3cnn(C4CCNCC4)c3)n2)c1F |
| InChI | InChI=1S/C28H35FN8S2/c1-5-15-38-36-21-8-6-7-20(23(21)29)24-25(39-26(35-24)28(2,3)4)22-11-14-31-27(34-22)33-18-16-32-37(17-18)19-9-12-30-13-10-19/h6-8,11,14,16-17,19,30,36H,5,9-10,12-13,15H2,1-4H3,(H,31,33,34) |
| InChIKey | VFEJYQPIDCGQOX-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 92.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.78 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|