C26H44P2 — CID 172570767
(2R,5R)-1-[2-[2,5-di(propan-2-yl)phospholan-1-yl]phenyl]-2,5-di(propan-2-yl)phospholane (PubChem CID 172570767) has the molecular formula C26H44P2 and a molecular weight of 418.59 g/mol. Its IUPAC name is (2R,5R)-1-[2-[2,5-di(propan-2-yl)phospholan-1-yl]phenyl]-2,5-di(propan-2-yl)phospholane.
| Compound Name | (2R,5R)-1-[2-[2,5-di(propan-2-yl)phospholan-1-yl]phenyl]-2,5-di(propan-2-yl)phospholane |
|---|---|
| PubChem CID | 172570767 |
| Molecular Formula | C26H44P2 |
| Molecular Weight | 418.59 g/mol |
| Exact Mass | 418.29 |
| IUPAC Name | (2R,5R)-1-[2-[2,5-di(propan-2-yl)phospholan-1-yl]phenyl]-2,5-di(propan-2-yl)phospholane |
| SMILES | CC(C)C1CCC(C(C)C)P1c1ccccc1P1[C@@H](C(C)C)CC[C@@H]1C(C)C |
| InChI | InChI=1S/C26H44P2/c1-17(2)21-13-14-22(18(3)4)27(21)25-11-9-10-12-26(25)28-23(19(5)6)15-16-24(28)20(7)8/h9-12,17-24H,13-16H2,1-8H3/t21-,22-,23?,24?,28?/m1/s1 |
| InChIKey | RBVGOQHQBUPSGX-ZTBPFWBPSA-N |
| XLogP | 7.59 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.59 |
| LogP ≤ 5 | 7.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|