About 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole
5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole (PubChem CID 172571034) has the molecular formula C14H13ClN2
and a molecular weight of 244.72 g/mol. Its IUPAC name is 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole |
| PubChem CID | 172571034 |
| Molecular Formula | C14H13ClN2 |
| Molecular Weight | 244.72 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole |
| SMILES | CC(C)c1ccc(Cl)c2c1[nH]c1ncccc12 |
| InChI | InChI=1S/C14H13ClN2/c1-8(2)9-5-6-11(15)12-10-4-3-7-16-14(10)17-13(9)12/h3-8H,1-2H3,(H,16,17) |
| InChIKey | FDWICLHVKDKQOR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.72 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole?
The IUPAC name of 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole (CID 172571034) is 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole.
What is the SMILES notation for 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole?
The canonical SMILES for 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole is CC(C)c1ccc(Cl)c2c1[nH]c1ncccc12.
What is the InChIKey of 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole?
The InChIKey is FDWICLHVKDKQOR-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13ClN2/c1-8(2)9-5-6-11(15)12-10-4-3-7-16-14(10)17-13(9)12/h3-8H,1-2H3,(H,16,17).
What are the key properties of 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole?
5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole has a molecular weight of 244.72 g/mol, XLogP of 4.49, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-8-propan-2-yl-9H-pyrido[2,3-b]indole is sourced from PubChem (CID 172571034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).