C18H22INO2 — CID 172571435
2-[(5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl)oxymethyl]benzonitrile (PubChem CID 172571435) has the molecular formula C18H22INO2 and a molecular weight of 411.28 g/mol. Its IUPAC name is 2-[(5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl)oxymethyl]benzonitrile.
| Compound Name | 2-[(5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl)oxymethyl]benzonitrile |
|---|---|
| PubChem CID | 172571435 |
| Molecular Formula | C18H22INO2 |
| Molecular Weight | 411.28 g/mol |
| Exact Mass | 411.07 |
| IUPAC Name | 2-[(5-iodo-1-methyl-4-propan-2-yl-7-oxabicyclo[2.2.1]heptan-2-yl)oxymethyl]benzonitrile |
| SMILES | CC(C)C12CC(OCc3ccccc3C#N)C(C)(CC1I)O2 |
| InChI | InChI=1S/C18H22INO2/c1-12(2)18-9-16(17(3,22-18)8-15(18)19)21-11-14-7-5-4-6-13(14)10-20/h4-7,12,15-16H,8-9,11H2,1-3H3 |
| InChIKey | LHNNXNOSPIOFNI-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.28 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|