C18H25ClO2 — CID 172571526
(1S,2R,4R,5S)-5-chloro-1-methyl-2-[(2-methylphenyl)methoxy]-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane (PubChem CID 172571526) has the molecular formula C18H25ClO2 and a molecular weight of 308.85 g/mol. Its IUPAC name is (1S,2R,4R,5S)-5-chloro-1-methyl-2-[(2-methylphenyl)methoxy]-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane.
| Compound Name | (1S,2R,4R,5S)-5-chloro-1-methyl-2-[(2-methylphenyl)methoxy]-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 172571526 |
| Molecular Formula | C18H25ClO2 |
| Molecular Weight | 308.85 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | (1S,2R,4R,5S)-5-chloro-1-methyl-2-[(2-methylphenyl)methoxy]-4-propan-2-yl-7-oxabicyclo[2.2.1]heptane |
| SMILES | Cc1ccccc1CO[C@@H]1C[C@]2(C(C)C)O[C@@]1(C)C[C@@H]2Cl |
| InChI | InChI=1S/C18H25ClO2/c1-12(2)18-10-16(17(4,21-18)9-15(18)19)20-11-14-8-6-5-7-13(14)3/h5-8,12,15-16H,9-11H2,1-4H3/t15-,16+,17-,18+/m0/s1 |
| InChIKey | QBDVPISQOHDKSM-XWTMOSNGSA-N |
| XLogP | 4.47 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.85 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|