About 1,1-diethyl-3-heptylurea
1,1-diethyl-3-heptylurea (PubChem CID 17257256) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,1-diethyl-3-heptylurea.
Molecular Properties
| Compound Name | 1,1-diethyl-3-heptylurea |
| PubChem CID | 17257256 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 1,1-diethyl-3-heptylurea |
| SMILES | CCCCCCCNC(=O)N(CC)CC |
| InChI | InChI=1S/C12H26N2O/c1-4-7-8-9-10-11-13-12(15)14(5-2)6-3/h4-11H2,1-3H3,(H,13,15) |
| InChIKey | AXMCXNHMCUCRPG-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethyl-3-heptylurea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethyl-3-heptylurea?
The IUPAC name of 1,1-diethyl-3-heptylurea (CID 17257256) is 1,1-diethyl-3-heptylurea.
What is the SMILES notation for 1,1-diethyl-3-heptylurea?
The canonical SMILES for 1,1-diethyl-3-heptylurea is CCCCCCCNC(=O)N(CC)CC.
What is the InChIKey of 1,1-diethyl-3-heptylurea?
The InChIKey is AXMCXNHMCUCRPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-4-7-8-9-10-11-13-12(15)14(5-2)6-3/h4-11H2,1-3H3,(H,13,15).
What are the key properties of 1,1-diethyl-3-heptylurea?
1,1-diethyl-3-heptylurea has a molecular weight of 214.35 g/mol, XLogP of 3.01, 8 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethyl-3-heptylurea is sourced from PubChem (CID 17257256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).