C24H32N8O2 — CID 172572993
(E)-ethoxy-[(14E)-3,5,8,20-tetramethyl-12-methylimino-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(22),2(6),3,14,16(23),18,20-heptaen-13-ylidene]methanamine (PubChem CID 172572993) has the molecular formula C24H32N8O2 and a molecular weight of 464.57 g/mol. Its IUPAC name is (E)-ethoxy-[(14E)-3,5,8,20-tetramethyl-12-methylimino-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(22),2(6),3,14,16(23),18,20-heptaen-13-ylidene]methanamine.
| Compound Name | (E)-ethoxy-[(14E)-3,5,8,20-tetramethyl-12-methylimino-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(22),2(6),3,14,16(23),18,20-heptaen-13-ylidene]methanamine |
|---|---|
| PubChem CID | 172572993 |
| Molecular Formula | C24H32N8O2 |
| Molecular Weight | 464.57 g/mol |
| Exact Mass | 464.26 |
| IUPAC Name | (E)-ethoxy-[(14E)-3,5,8,20-tetramethyl-12-methylimino-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(22),2(6),3,14,16(23),18,20-heptaen-13-ylidene]methanamine |
| SMILES | CCO/C(N)=C1\C=C/c2[nH]nc3c(C)nc(cc23)-c2c(C)nn(C)c2OC(C)CNC\C1=N/C |
| InChI | InChI=1S/C24H32N8O2/c1-7-33-23(25)16-8-9-18-17-10-19(28-15(4)22(17)30-29-18)21-14(3)31-32(6)24(21)34-13(2)11-27-12-20(16)26-5/h8-10,13,27H,7,11-12,25H2,1-6H3,(H,29,30)/b9-8-,23-16+,26-20+ |
| InChIKey | RZUJQMVNJLXHSQ-HUTLWWKNSA-N |
| XLogP | 2.64 |
| TPSA | 128.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.57 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|