C24H28IN8O3P — CID 172573466
(9R,20E)-16-(2-hydroxyethyl)-24-iodophosphanyl-3,5-dimethyl-7-oxa-4,5,13,16,17,23,24,27-octazahexacyclo[20.5.2.02,6.09,13.015,19.025,29]nonacosa-1(27),2(6),3,15(19),20,22,25,28-octaen-18-one (PubChem CID 172573466) has the molecular formula C24H28IN8O3P and a molecular weight of 634.42 g/mol. Its IUPAC name is (9R,20E)-16-(2-hydroxyethyl)-24-iodophosphanyl-3,5-dimethyl-7-oxa-4,5,13,16,17,23,24,27-octazahexacyclo[20.5.2.02,6.09,13.015,19.025,29]nonacosa-1(27),2(6),3,15(19),20,22,25,28-octaen-18-one.
| Compound Name | (9R,20E)-16-(2-hydroxyethyl)-24-iodophosphanyl-3,5-dimethyl-7-oxa-4,5,13,16,17,23,24,27-octazahexacyclo[20.5.2.02,6.09,13.015,19.025,29]nonacosa-1(27),2(6),3,15(19),20,22,25,28-octaen-18-one |
|---|---|
| PubChem CID | 172573466 |
| Molecular Formula | C24H28IN8O3P |
| Molecular Weight | 634.42 g/mol |
| Exact Mass | 634.11 |
| IUPAC Name | (9R,20E)-16-(2-hydroxyethyl)-24-iodophosphanyl-3,5-dimethyl-7-oxa-4,5,13,16,17,23,24,27-octazahexacyclo[20.5.2.02,6.09,13.015,19.025,29]nonacosa-1(27),2(6),3,15(19),20,22,25,28-octaen-18-one |
| SMILES | Cc1nn(C)c2c1-c1cc3c(nn(PI)c3cn1)/C=C/c1c(n(CCO)[nH]c1=O)CN1CCC[C@@H]1CO2 |
| InChI | InChI=1S/C24H28IN8O3P/c1-14-22-19-10-17-18(28-33(37-25)20(17)11-26-19)6-5-16-21(32(8-9-34)29-23(16)35)12-31-7-3-4-15(31)13-36-24(22)30(2)27-14/h5-6,10-11,15,34,37H,3-4,7-9,12-13H2,1-2H3,(H,29,35)/b6-5+/t15-/m1/s1 |
| InChIKey | IJWQLANTNMZBRN-LLYBFZRZSA-N |
| XLogP | 2.94 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.42 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|