C25H31N9O3 — CID 172573510
2-[(E)-amino-[(14E)-12-(1-hydroxypropan-2-ylimino)-3,5,10-trimethyl-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(21),2(6),3,14,16,19,22-heptaen-13-ylidene]methoxy]acetonitrile (PubChem CID 172573510) has the molecular formula C25H31N9O3 and a molecular weight of 505.58 g/mol. Its IUPAC name is 2-[(E)-amino-[(14E)-12-(1-hydroxypropan-2-ylimino)-3,5,10-trimethyl-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(21),2(6),3,14,16,19,22-heptaen-13-ylidene]methoxy]acetonitrile.
| Compound Name | 2-[(E)-amino-[(14E)-12-(1-hydroxypropan-2-ylimino)-3,5,10-trimethyl-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(21),2(6),3,14,16,19,22-heptaen-13-ylidene]methoxy]acetonitrile |
|---|---|
| PubChem CID | 172573510 |
| Molecular Formula | C25H31N9O3 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.25 |
| IUPAC Name | 2-[(E)-amino-[(14E)-12-(1-hydroxypropan-2-ylimino)-3,5,10-trimethyl-7-oxa-4,5,10,17,18,21-hexazatetracyclo[14.5.2.02,6.019,23]tricosa-1(21),2(6),3,14,16,19,22-heptaen-13-ylidene]methoxy]acetonitrile |
| SMILES | Cc1nn(C)c2c1-c1cc3c(n[nH]c3cn1)/C=C\C(=C(\N)OCC#N)\C(=N\C(C)CO)CN(C)CCO2 |
| InChI | InChI=1S/C25H31N9O3/c1-15(14-35)29-22-13-33(3)8-10-37-25-23(16(2)32-34(25)4)20-11-18-19(30-31-21(18)12-28-20)6-5-17(22)24(27)36-9-7-26/h5-6,11-12,15,35H,8-10,13-14,27H2,1-4H3,(H,30,31)/b6-5-,24-17+,29-22+ |
| InChIKey | HFJGQMUAPTWQQF-RLAUXPQGSA-N |
| XLogP | 1.54 |
| TPSA | 163.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|