About CID 172574566
CID 172574566 (PubChem CID 172574566) has the molecular formula C28H31B2N7O6
and a molecular weight of 583.22 g/mol.
Molecular Properties
| Compound Name | CID 172574566 |
| PubChem CID | 172574566 |
| Molecular Formula | C28H31B2N7O6 |
| Molecular Weight | 583.22 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | — |
| SMILES | [B]C(O)(O)N(Cc1cc(-c2cc3nc(N4C=CC(c5cccc(C)c5)N4)cc(N4CCOCC4)c3o2)nn1C)C([B])(O)O |
| InChI | InChI=1S/C28H31B2N7O6/c1-17-4-3-5-18(12-17)20-6-7-36(33-20)25-15-23(35-8-10-42-11-9-35)26-22(31-25)14-24(43-26)21-13-19(34(2)32-21)16-37(27(29,38)39)28(30,40)41/h3-7,12-15,20,33,38-41H,8-11,16H2,1-2H3 |
| InChIKey | SEYBLTAREZWAFB-UHFFFAOYSA-N |
| XLogP | 0.28 |
| TPSA | 155.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 583.22 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 172574566 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172574566?
The IUPAC name of CID 172574566 (CID 172574566) is not available.
What is the SMILES notation for CID 172574566?
The canonical SMILES for CID 172574566 is [B]C(O)(O)N(Cc1cc(-c2cc3nc(N4C=CC(c5cccc(C)c5)N4)cc(N4CCOCC4)c3o2)nn1C)C([B])(O)O.
What is the InChIKey of CID 172574566?
The InChIKey is SEYBLTAREZWAFB-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H31B2N7O6/c1-17-4-3-5-18(12-17)20-6-7-36(33-20)25-15-23(35-8-10-42-11-9-35)26-22(31-25)14-24(43-26)21-13-19(34(2)32-21)16-37(27(29,38)39)28(30,40)41/h3-7,12-15,20,33,38-41H,8-11,16H2,1-2H3.
What are the key properties of CID 172574566?
CID 172574566 has a molecular weight of 583.22 g/mol, XLogP of 0.28, 8 rotatable bonds, 5 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172574566 is sourced from PubChem (CID 172574566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).