C24H36FmN5O5S- — CID 172574830
fermium;methyl 2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-6-(oxomethylamino)hexanoate;3-methyl-1H-indole (PubChem CID 172574830) has the molecular formula C24H36FmN5O5S- and a molecular weight of 763.65 g/mol. Its IUPAC name is fermium;methyl 2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-6-(oxomethylamino)hexanoate;3-methyl-1H-indole.
| Compound Name | fermium;methyl 2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-6-(oxomethylamino)hexanoate;3-methyl-1H-indole |
|---|---|
| PubChem CID | 172574830 |
| Molecular Formula | C24H36FmN5O5S- |
| Molecular Weight | 763.65 g/mol |
| Exact Mass | 763.34 |
| IUPAC Name | fermium;methyl 2-[[2-[(2-aminoacetyl)amino]-4-methylsulfanylbutanoyl]amino]-6-(oxomethylamino)hexanoate;3-methyl-1H-indole |
| SMILES | COC(=O)C(CCCCN[C-]=O)NC(=O)C(CCSC)NC(=O)CN.Cc1c[nH]c2ccccc12.[Fm] |
| InChI | InChI=1S/C15H27N4O5S.C9H9N.Fm/c1-24-15(23)12(5-3-4-7-17-10-20)19-14(22)11(6-8-25-2)18-13(21)9-16;1-7-6-10-9-5-3-2-4-8(7)9;/h11-12H,3-9,16H2,1-2H3,(H,17,20)(H,18,21)(H,19,22);2-6,10H,1H3;/q-1;; |
| InChIKey | VGKCQMRHIKIUQS-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 155.41 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.65 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|