About (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene
(7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene (PubChem CID 172575137) has the molecular formula C10H17NO
and a molecular weight of 167.25 g/mol. Its IUPAC name is (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene.
Molecular Properties
| Compound Name | (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene |
| PubChem CID | 172575137 |
| Molecular Formula | C10H17NO |
| Molecular Weight | 167.25 g/mol |
| Exact Mass | 167.13 |
| IUPAC Name | (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene |
| SMILES | CC1=CCOC12CCN[C@H](C)C2 |
| InChI | InChI=1S/C10H17NO/c1-8-3-6-12-10(8)4-5-11-9(2)7-10/h3,9,11H,4-7H2,1-2H3/t9-,10?/m1/s1 |
| InChIKey | XUJOWGFPVWUYDF-YHMJZVADSA-N |
| XLogP | 1.47 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.25 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene?
The IUPAC name of (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene (CID 172575137) is (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene.
What is the SMILES notation for (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene?
The canonical SMILES for (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene is CC1=CCOC12CCN[C@H](C)C2.
What is the InChIKey of (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene?
The InChIKey is XUJOWGFPVWUYDF-YHMJZVADSA-N. The full InChI is InChI=1S/C10H17NO/c1-8-3-6-12-10(8)4-5-11-9(2)7-10/h3,9,11H,4-7H2,1-2H3/t9-,10?/m1/s1.
What are the key properties of (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene?
(7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene has a molecular weight of 167.25 g/mol, XLogP of 1.47, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-4,7-dimethyl-1-oxa-8-azaspiro[4.5]dec-3-ene is sourced from PubChem (CID 172575137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).