About spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine]
spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] (PubChem CID 172575182) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine].
Molecular Properties
| Compound Name | spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] |
| PubChem CID | 172575182 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] |
| SMILES | C1=CCC2C(=C1)OCC21CCNCC1 |
| InChI | InChI=1S/C12H17NO/c1-2-4-11-10(3-1)12(9-14-11)5-7-13-8-6-12/h1-2,4,10,13H,3,5-9H2 |
| InChIKey | WCNHXVYAIJDICK-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine]?
The IUPAC name of spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] (CID 172575182) is spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine].
What is the SMILES notation for spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine]?
The canonical SMILES for spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] is C1=CCC2C(=C1)OCC21CCNCC1.
What is the InChIKey of spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine]?
The InChIKey is WCNHXVYAIJDICK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-2-4-11-10(3-1)12(9-14-11)5-7-13-8-6-12/h1-2,4,10,13H,3,5-9H2.
What are the key properties of spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine]?
spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] has a molecular weight of 191.27 g/mol, XLogP of 1.85, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[3a,4-dihydro-2H-1-benzofuran-3,4'-piperidine] is sourced from PubChem (CID 172575182), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).