About N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane
N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane (PubChem CID 172575190) has the molecular formula C10H25FN2S
and a molecular weight of 224.39 g/mol. Its IUPAC name is N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane.
Molecular Properties
| Compound Name | N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane |
| PubChem CID | 172575190 |
| Molecular Formula | C10H25FN2S |
| Molecular Weight | 224.39 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane |
| SMILES | CC(C)N(C)CCSN(C)C.CCF |
| InChI | InChI=1S/C8H20N2S.C2H5F/c1-8(2)10(5)6-7-11-9(3)4;1-2-3/h8H,6-7H2,1-5H3;2H2,1H3 |
| InChIKey | LQLSYWDATRJFGF-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.39 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane?
The IUPAC name of N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane (CID 172575190) is N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane.
What is the SMILES notation for N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane?
The canonical SMILES for N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane is CC(C)N(C)CCSN(C)C.CCF.
What is the InChIKey of N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane?
The InChIKey is LQLSYWDATRJFGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H20N2S.C2H5F/c1-8(2)10(5)6-7-11-9(3)4;1-2-3/h8H,6-7H2,1-5H3;2H2,1H3.
What are the key properties of N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane?
N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane has a molecular weight of 224.39 g/mol, XLogP of 2.51, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(dimethylaminosulfanyl)ethyl]-N-methylpropan-2-amine;fluoroethane is sourced from PubChem (CID 172575190), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).