About ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile
ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile (PubChem CID 172575393) has the molecular formula C17H27F3N2
and a molecular weight of 316.41 g/mol. Its IUPAC name is ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile.
Molecular Properties
| Compound Name | ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile |
| PubChem CID | 172575393 |
| Molecular Formula | C17H27F3N2 |
| Molecular Weight | 316.41 g/mol |
| Exact Mass | 316.21 |
| IUPAC Name | ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile |
| SMILES | CC.CC.CC1=CC(C(C)C)=CC(C#N)C(CC(F)(F)F)=N1 |
| InChI | InChI=1S/C13H15F3N2.2C2H6/c1-8(2)10-4-9(3)18-12(6-13(14,15)16)11(5-10)7-17;2*1-2/h4-5,8,11H,6H2,1-3H3;2*1-2H3 |
| InChIKey | IKWHQGMITFXCID-UHFFFAOYSA-N |
| XLogP | 6.07 |
| TPSA | 36.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 316.41 |
| LogP ≤ 5 | 6.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile?
The IUPAC name of ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile (CID 172575393) is ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile.
What is the SMILES notation for ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile?
The canonical SMILES for ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile is CC.CC.CC1=CC(C(C)C)=CC(C#N)C(CC(F)(F)F)=N1.
What is the InChIKey of ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile?
The InChIKey is IKWHQGMITFXCID-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15F3N2.2C2H6/c1-8(2)10-4-9(3)18-12(6-13(14,15)16)11(5-10)7-17;2*1-2/h4-5,8,11H,6H2,1-3H3;2*1-2H3.
What are the key properties of ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile?
ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile has a molecular weight of 316.41 g/mol, XLogP of 6.07, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;7-methyl-5-propan-2-yl-2-(2,2,2-trifluoroethyl)-3H-azepine-3-carbonitrile is sourced from PubChem (CID 172575393), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).