C20H19ClF3N7OS2 — CID 172575650
7-[2-[5-amino-4-[amino(methyl)amino]-2-chloroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one (PubChem CID 172575650) has the molecular formula C20H19ClF3N7OS2 and a molecular weight of 530.00 g/mol. Its IUPAC name is 7-[2-[5-amino-4-[amino(methyl)amino]-2-chloroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one.
| Compound Name | 7-[2-[5-amino-4-[amino(methyl)amino]-2-chloroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
|---|---|
| PubChem CID | 172575650 |
| Molecular Formula | C20H19ClF3N7OS2 |
| Molecular Weight | 530.00 g/mol |
| Exact Mass | 529.07 |
| IUPAC Name | 7-[2-[5-amino-4-[amino(methyl)amino]-2-chloroanilino]-5-(trifluoromethyl)pyrimidin-4-yl]-4-methyl-2,3-dihydrothieno[2,3-f][1,4]thiazepin-5-one |
| SMILES | CN1CCSc2cc(-c3nc(Nc4cc(N)c(N(C)N)cc4Cl)ncc3C(F)(F)F)sc2C1=O |
| InChI | InChI=1S/C20H19ClF3N7OS2/c1-30-3-4-33-15-7-14(34-17(15)18(30)32)16-9(20(22,23)24)8-27-19(29-16)28-12-6-11(25)13(31(2)26)5-10(12)21/h5-8H,3-4,25-26H2,1-2H3,(H,27,28,29) |
| InChIKey | XIISSZOVNQVAIQ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.00 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|