About 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane (PubChem CID 172575816) has the molecular formula C16H25NO
and a molecular weight of 247.38 g/mol. Its IUPAC name is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane.
Molecular Properties
| Compound Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane |
| PubChem CID | 172575816 |
| Molecular Formula | C16H25NO |
| Molecular Weight | 247.38 g/mol |
| Exact Mass | 247.19 |
| IUPAC Name | 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane |
| SMILES | C=C/C=C\c1c(C(C)C)noc1C=C.CC(C)C |
| InChI | InChI=1S/C12H15NO.C4H10/c1-5-7-8-10-11(6-2)14-13-12(10)9(3)4;1-4(2)3/h5-9H,1-2H2,3-4H3;4H,1-3H3/b8-7-; |
| InChIKey | LJVIRRCWERPDSK-CFYXSCKTSA-N |
| XLogP | 5.30 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 247.38 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane?
The IUPAC name of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane (CID 172575816) is 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane.
What is the SMILES notation for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane?
The canonical SMILES for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane is C=C/C=C\c1c(C(C)C)noc1C=C.CC(C)C.
What is the InChIKey of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane?
The InChIKey is LJVIRRCWERPDSK-CFYXSCKTSA-N. The full InChI is InChI=1S/C12H15NO.C4H10/c1-5-7-8-10-11(6-2)14-13-12(10)9(3)4;1-4(2)3/h5-9H,1-2H2,3-4H3;4H,1-3H3/b8-7-;.
What are the key properties of 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane?
4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane has a molecular weight of 247.38 g/mol, XLogP of 5.30, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(1Z)-buta-1,3-dienyl]-5-ethenyl-3-propan-2-yl-1,2-oxazole;2-methylpropane is sourced from PubChem (CID 172575816), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).