About propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine
propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine (PubChem CID 172576033) has the molecular formula C15H27N3O
and a molecular weight of 265.40 g/mol. Its IUPAC name is propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine.
Molecular Properties
| Compound Name | propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine |
| PubChem CID | 172576033 |
| Molecular Formula | C15H27N3O |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.22 |
| IUPAC Name | propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine |
| SMILES | CC(C)N.CC(C)c1ccc(N2CCOCC2)cn1 |
| InChI | InChI=1S/C12H18N2O.C3H9N/c1-10(2)12-4-3-11(9-13-12)14-5-7-15-8-6-14;1-3(2)4/h3-4,9-10H,5-8H2,1-2H3;3H,4H2,1-2H3 |
| InChIKey | KAVMBWPDTAPMPY-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine?
The IUPAC name of propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine (CID 172576033) is propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine.
What is the SMILES notation for propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine?
The canonical SMILES for propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine is CC(C)N.CC(C)c1ccc(N2CCOCC2)cn1.
What is the InChIKey of propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine?
The InChIKey is KAVMBWPDTAPMPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2O.C3H9N/c1-10(2)12-4-3-11(9-13-12)14-5-7-15-8-6-14;1-3(2)4/h3-4,9-10H,5-8H2,1-2H3;3H,4H2,1-2H3.
What are the key properties of propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine?
propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine has a molecular weight of 265.40 g/mol, XLogP of 2.40, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-amine;4-(6-propan-2-yl-3-pyridinyl)morpholine is sourced from PubChem (CID 172576033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).