About methanol;3-methoxy-1-propan-2-ylpiperidine
methanol;3-methoxy-1-propan-2-ylpiperidine (PubChem CID 172576314) has the molecular formula C10H23NO2
and a molecular weight of 189.30 g/mol. Its IUPAC name is methanol;3-methoxy-1-propan-2-ylpiperidine.
Molecular Properties
| Compound Name | methanol;3-methoxy-1-propan-2-ylpiperidine |
| PubChem CID | 172576314 |
| Molecular Formula | C10H23NO2 |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.17 |
| IUPAC Name | methanol;3-methoxy-1-propan-2-ylpiperidine |
| SMILES | CO.COC1CCCN(C(C)C)C1 |
| InChI | InChI=1S/C9H19NO.CH4O/c1-8(2)10-6-4-5-9(7-10)11-3;1-2/h8-9H,4-7H2,1-3H3;2H,1H3 |
| InChIKey | GMMWAOXAYHGIEA-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methanol;3-methoxy-1-propan-2-ylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanol;3-methoxy-1-propan-2-ylpiperidine?
The IUPAC name of methanol;3-methoxy-1-propan-2-ylpiperidine (CID 172576314) is methanol;3-methoxy-1-propan-2-ylpiperidine.
What is the SMILES notation for methanol;3-methoxy-1-propan-2-ylpiperidine?
The canonical SMILES for methanol;3-methoxy-1-propan-2-ylpiperidine is CO.COC1CCCN(C(C)C)C1.
What is the InChIKey of methanol;3-methoxy-1-propan-2-ylpiperidine?
The InChIKey is GMMWAOXAYHGIEA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO.CH4O/c1-8(2)10-6-4-5-9(7-10)11-3;1-2/h8-9H,4-7H2,1-3H3;2H,1H3.
What are the key properties of methanol;3-methoxy-1-propan-2-ylpiperidine?
methanol;3-methoxy-1-propan-2-ylpiperidine has a molecular weight of 189.30 g/mol, XLogP of 1.11, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methanol;3-methoxy-1-propan-2-ylpiperidine is sourced from PubChem (CID 172576314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).