About 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one
2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one (PubChem CID 172576494) has the molecular formula C9H10ClN3O2
and a molecular weight of 227.65 g/mol. Its IUPAC name is 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one.
Molecular Properties
| Compound Name | 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one |
| PubChem CID | 172576494 |
| Molecular Formula | C9H10ClN3O2 |
| Molecular Weight | 227.65 g/mol |
| Exact Mass | 227.05 |
| IUPAC Name | 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one |
| SMILES | CCOc1nc(Cl)nc2c1C(=O)NCC2 |
| InChI | InChI=1S/C9H10ClN3O2/c1-2-15-8-6-5(12-9(10)13-8)3-4-11-7(6)14/h2-4H2,1H3,(H,11,14) |
| InChIKey | NWXWAGJTFANEBZ-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.65 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one?
The IUPAC name of 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one (CID 172576494) is 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one.
What is the SMILES notation for 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one?
The canonical SMILES for 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one is CCOc1nc(Cl)nc2c1C(=O)NCC2.
What is the InChIKey of 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one?
The InChIKey is NWXWAGJTFANEBZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClN3O2/c1-2-15-8-6-5(12-9(10)13-8)3-4-11-7(6)14/h2-4H2,1H3,(H,11,14).
What are the key properties of 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one?
2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one has a molecular weight of 227.65 g/mol, XLogP of 0.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-4-ethoxy-7,8-dihydro-6H-pyrido[4,3-d]pyrimidin-5-one is sourced from PubChem (CID 172576494), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).