About 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine
2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 172576502) has the molecular formula C9H10ClF2N3O
and a molecular weight of 249.65 g/mol. Its IUPAC name is 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
Molecular Properties
| Compound Name | 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| PubChem CID | 172576502 |
| Molecular Formula | C9H10ClF2N3O |
| Molecular Weight | 249.65 g/mol |
| Exact Mass | 249.05 |
| IUPAC Name | 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | COc1nc(Cl)nc2c1CN(C(F)F)CC2 |
| InChI | InChI=1S/C9H10ClF2N3O/c1-16-7-5-4-15(9(11)12)3-2-6(5)13-8(10)14-7/h9H,2-4H2,1H3 |
| InChIKey | WZAHFICOLDCIAO-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.65 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine?
The IUPAC name of 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (CID 172576502) is 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
What is the SMILES notation for 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine?
The canonical SMILES for 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine is COc1nc(Cl)nc2c1CN(C(F)F)CC2.
What is the InChIKey of 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine?
The InChIKey is WZAHFICOLDCIAO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10ClF2N3O/c1-16-7-5-4-15(9(11)12)3-2-6(5)13-8(10)14-7/h9H,2-4H2,1H3.
What are the key properties of 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine?
2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine has a molecular weight of 249.65 g/mol, XLogP of 1.72, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6-(difluoromethyl)-4-methoxy-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine is sourced from PubChem (CID 172576502), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).