About 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine
2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (PubChem CID 172576511) has the molecular formula C7H8FN3O
and a molecular weight of 169.16 g/mol. Its IUPAC name is 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| PubChem CID | 172576511 |
| Molecular Formula | C7H8FN3O |
| Molecular Weight | 169.16 g/mol |
| Exact Mass | 169.07 |
| IUPAC Name | 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine |
| SMILES | COc1nc(F)nc2c1CNC2 |
| InChI | InChI=1S/C7H8FN3O/c1-12-6-4-2-9-3-5(4)10-7(8)11-6/h9H,2-3H2,1H3 |
| InChIKey | VCIPKAMIXLOOOI-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.16 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The IUPAC name of 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine (CID 172576511) is 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine.
What is the SMILES notation for 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The canonical SMILES for 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is COc1nc(F)nc2c1CNC2.
What is the InChIKey of 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
The InChIKey is VCIPKAMIXLOOOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8FN3O/c1-12-6-4-2-9-3-5(4)10-7(8)11-6/h9H,2-3H2,1H3.
What are the key properties of 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine?
2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine has a molecular weight of 169.16 g/mol, XLogP of 0.23, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluoro-4-methoxy-6,7-dihydro-5H-pyrrolo[3,4-d]pyrimidine is sourced from PubChem (CID 172576511), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).