C36H46ClN7O2 — CID 172577082
(E)-1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-(dimethylamino)pent-2-en-1-one (PubChem CID 172577082) has the molecular formula C36H46ClN7O2 and a molecular weight of 644.26 g/mol. Its IUPAC name is (E)-1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-(dimethylamino)pent-2-en-1-one.
| Compound Name | (E)-1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-(dimethylamino)pent-2-en-1-one |
|---|---|
| PubChem CID | 172577082 |
| Molecular Formula | C36H46ClN7O2 |
| Molecular Weight | 644.26 g/mol |
| Exact Mass | 643.34 |
| IUPAC Name | (E)-1-[4-[7-(8-chloronaphthalen-1-yl)-2-(1,2,3,5,6,7-hexahydropyrrolizin-8-ylmethoxy)-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-4-yl]piperazin-1-yl]-4-(dimethylamino)pent-2-en-1-one |
| SMILES | CC(/C=C/C(=O)N1CCN(c2nc(OCC34CCCN3CCC4)nc3c2CCN(c2cccc4cccc(Cl)c24)C3)CC1)N(C)C |
| InChI | InChI=1S/C36H46ClN7O2/c1-26(40(2)3)12-13-32(45)41-20-22-42(23-21-41)34-28-14-19-43(31-11-5-9-27-8-4-10-29(37)33(27)31)24-30(28)38-35(39-34)46-25-36-15-6-17-44(36)18-7-16-36/h4-5,8-13,26H,6-7,14-25H2,1-3H3/b13-12+ |
| InChIKey | LIOYRXZANOLTLL-OUKQBFOZSA-N |
| XLogP | 5.01 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.26 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|