About (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine
(4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine (PubChem CID 172577484) has the molecular formula C7H12FN
and a molecular weight of 129.18 g/mol. Its IUPAC name is (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine.
Molecular Properties
| Compound Name | (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine |
| PubChem CID | 172577484 |
| Molecular Formula | C7H12FN |
| Molecular Weight | 129.18 g/mol |
| Exact Mass | 129.10 |
| IUPAC Name | (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine |
| SMILES | CC1C/C(=C\F)CN1C |
| InChI | InChI=1S/C7H12FN/c1-6-3-7(4-8)5-9(6)2/h4,6H,3,5H2,1-2H3/b7-4+ |
| InChIKey | LIGRLKRTLBTDPH-QPJJXVBHSA-N |
| XLogP | 1.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.18 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine?
The IUPAC name of (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine (CID 172577484) is (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine.
What is the SMILES notation for (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine?
The canonical SMILES for (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine is CC1C/C(=C\F)CN1C.
What is the InChIKey of (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine?
The InChIKey is LIGRLKRTLBTDPH-QPJJXVBHSA-N. The full InChI is InChI=1S/C7H12FN/c1-6-3-7(4-8)5-9(6)2/h4,6H,3,5H2,1-2H3/b7-4+.
What are the key properties of (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine?
(4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine has a molecular weight of 129.18 g/mol, XLogP of 1.56, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-4-(fluoromethylidene)-1,2-dimethylpyrrolidine is sourced from PubChem (CID 172577484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).