C10H16FNO — CID 172577529
1-[(3aR,5S)-5-fluoro-3a-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone (PubChem CID 172577529) has the molecular formula C10H16FNO and a molecular weight of 185.24 g/mol. Its IUPAC name is 1-[(3aR,5S)-5-fluoro-3a-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone.
| Compound Name | 1-[(3aR,5S)-5-fluoro-3a-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone |
|---|---|
| PubChem CID | 172577529 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 1-[(3aR,5S)-5-fluoro-3a-methyl-1,3,4,5,6,6a-hexahydrocyclopenta[c]pyrrol-2-yl]ethanone |
| SMILES | CC(=O)N1CC2C[C@H](F)C[C@@]2(C)C1 |
| InChI | InChI=1S/C10H16FNO/c1-7(13)12-5-8-3-9(11)4-10(8,2)6-12/h8-9H,3-6H2,1-2H3/t8?,9-,10-/m0/s1 |
| InChIKey | NPIHLJOUHMSQLZ-AGROOBSYSA-N |
| XLogP | 1.60 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |