C18H20N2O2 — CID 172578240
methyl 2-[1-[4-(2-methyl-4-pyridinyl)phenyl]azetidin-3-yl]acetate (PubChem CID 172578240) has the molecular formula C18H20N2O2 and a molecular weight of 296.37 g/mol. Its IUPAC name is methyl 2-[1-[4-(2-methyl-4-pyridinyl)phenyl]azetidin-3-yl]acetate.
| Compound Name | methyl 2-[1-[4-(2-methyl-4-pyridinyl)phenyl]azetidin-3-yl]acetate |
|---|---|
| PubChem CID | 172578240 |
| Molecular Formula | C18H20N2O2 |
| Molecular Weight | 296.37 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | methyl 2-[1-[4-(2-methyl-4-pyridinyl)phenyl]azetidin-3-yl]acetate |
| SMILES | COC(=O)CC1CN(c2ccc(-c3ccnc(C)c3)cc2)C1 |
| InChI | InChI=1S/C18H20N2O2/c1-13-9-16(7-8-19-13)15-3-5-17(6-4-15)20-11-14(12-20)10-18(21)22-2/h3-9,14H,10-12H2,1-2H3 |
| InChIKey | UHJRJMPHZTYNMF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.37 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |