C18H20ClN — CID 172578340
N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride (PubChem CID 172578340) has the molecular formula C18H20ClN and a molecular weight of 285.82 g/mol. Its IUPAC name is N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride.
| Compound Name | N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 172578340 |
| Molecular Formula | C18H20ClN |
| Molecular Weight | 285.82 g/mol |
| Exact Mass | 285.13 |
| IUPAC Name | N-propan-2-yltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride |
| SMILES | CC(C)NC1c2ccccc2C=Cc2ccccc21.Cl |
| InChI | InChI=1S/C18H19N.ClH/c1-13(2)19-18-16-9-5-3-7-14(16)11-12-15-8-4-6-10-17(15)18;/h3-13,18-19H,1-2H3;1H |
| InChIKey | LEMNYLNCULRHCI-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.82 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|