C17H18ClN — CID 172578358
N-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride (PubChem CID 172578358) has the molecular formula C17H18ClN and a molecular weight of 271.79 g/mol. Its IUPAC name is N-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride.
| Compound Name | N-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride |
|---|---|
| PubChem CID | 172578358 |
| Molecular Formula | C17H18ClN |
| Molecular Weight | 271.79 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | N-ethyltricyclo[9.4.0.03,8]pentadeca-1(15),3,5,7,9,11,13-heptaen-2-amine;hydrochloride |
| SMILES | CCNC1c2ccccc2C=Cc2ccccc21.Cl |
| InChI | InChI=1S/C17H17N.ClH/c1-2-18-17-15-9-5-3-7-13(15)11-12-14-8-4-6-10-16(14)17;/h3-12,17-18H,2H2,1H3;1H |
| InChIKey | CDTDPXNVYLLZPI-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.79 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|