C28H41N3 — CID 172578829
N'-(cyclooctatetraenylmethyl)-N-methyl-N'-[(3-methyl-2,3-dihydropyridin-6-yl)methyl]-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]ethane-1,2-diamine;methane (PubChem CID 172578829) has the molecular formula C28H41N3 and a molecular weight of 419.66 g/mol. Its IUPAC name is N'-(cyclooctatetraenylmethyl)-N-methyl-N'-[(3-methyl-2,3-dihydropyridin-6-yl)methyl]-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]ethane-1,2-diamine;methane.
| Compound Name | N'-(cyclooctatetraenylmethyl)-N-methyl-N'-[(3-methyl-2,3-dihydropyridin-6-yl)methyl]-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]ethane-1,2-diamine;methane |
|---|---|
| PubChem CID | 172578829 |
| Molecular Formula | C28H41N3 |
| Molecular Weight | 419.66 g/mol |
| Exact Mass | 419.33 |
| IUPAC Name | N'-(cyclooctatetraenylmethyl)-N-methyl-N'-[(3-methyl-2,3-dihydropyridin-6-yl)methyl]-N-[(2E,4Z)-2-methylhepta-2,4,6-trienyl]ethane-1,2-diamine;methane |
| SMILES | C.C=C/C=C\C=C(/C)CN(C)CCN(CC1=NCC(C)C=C1)CC1=C/C=C\C=C/C=C\1 |
| InChI | InChI=1S/C27H37N3.CH4/c1-5-6-10-13-25(3)21-29(4)18-19-30(23-27-17-16-24(2)20-28-27)22-26-14-11-8-7-9-12-15-26;/h5-17,24H,1,18-23H2,2-4H3;1H4/b8-7-,9-7-,10-6-,11-8-,12-9-,14-11-,15-12-,25-13+,26-14+,26-15+; |
| InChIKey | AJJVBZWBKFMPJK-CTXSXDTQSA-N |
| XLogP | 5.80 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.66 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|