About CID 172578996
CID 172578996 (PubChem CID 172578996) has the molecular formula C8H10BN2O
and a molecular weight of 160.99 g/mol.
Molecular Properties
| Compound Name | CID 172578996 |
| PubChem CID | 172578996 |
| Molecular Formula | C8H10BN2O |
| Molecular Weight | 160.99 g/mol |
| Exact Mass | 161.09 |
| IUPAC Name | — |
| SMILES | Nc1cc([B]O)cc(C2CC2)n1 |
| InChI | InChI=1S/C8H10BN2O/c10-8-4-6(9-12)3-7(11-8)5-1-2-5/h3-5,12H,1-2H2,(H2,10,11) |
| InChIKey | WVZSEQZYICKRSR-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 59.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.99 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 172578996 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 172578996?
The IUPAC name of CID 172578996 (CID 172578996) is not available.
What is the SMILES notation for CID 172578996?
The canonical SMILES for CID 172578996 is Nc1cc([B]O)cc(C2CC2)n1.
What is the InChIKey of CID 172578996?
The InChIKey is WVZSEQZYICKRSR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10BN2O/c10-8-4-6(9-12)3-7(11-8)5-1-2-5/h3-5,12H,1-2H2,(H2,10,11).
What are the key properties of CID 172578996?
CID 172578996 has a molecular weight of 160.99 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 172578996 is sourced from PubChem (CID 172578996), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).