C28H44N4O6 — CID 172579701
methyl (1S,4S,6S,10R,15S,19S,21R)-15-(3,3-dimethylbutanoylamino)-20,20-dimethyl-2,7,16-trioxo-3,8,17-triazatetracyclo[15.4.0.06,10.019,21]henicosane-4-carboxylate (PubChem CID 172579701) has the molecular formula C28H44N4O6 and a molecular weight of 532.68 g/mol. Its IUPAC name is methyl (1S,4S,6S,10R,15S,19S,21R)-15-(3,3-dimethylbutanoylamino)-20,20-dimethyl-2,7,16-trioxo-3,8,17-triazatetracyclo[15.4.0.06,10.019,21]henicosane-4-carboxylate.
| Compound Name | methyl (1S,4S,6S,10R,15S,19S,21R)-15-(3,3-dimethylbutanoylamino)-20,20-dimethyl-2,7,16-trioxo-3,8,17-triazatetracyclo[15.4.0.06,10.019,21]henicosane-4-carboxylate |
|---|---|
| PubChem CID | 172579701 |
| Molecular Formula | C28H44N4O6 |
| Molecular Weight | 532.68 g/mol |
| Exact Mass | 532.33 |
| IUPAC Name | methyl (1S,4S,6S,10R,15S,19S,21R)-15-(3,3-dimethylbutanoylamino)-20,20-dimethyl-2,7,16-trioxo-3,8,17-triazatetracyclo[15.4.0.06,10.019,21]henicosane-4-carboxylate |
| SMILES | COC(=O)[C@@H]1C[C@@H]2C(=O)NC[C@@H]2CCCC[C@H](NC(=O)CC(C)(C)C)C(=O)N2C[C@H]3[C@@H]([C@H]2C(=O)N1)C3(C)C |
| InChI | InChI=1S/C28H44N4O6/c1-27(2,3)12-20(33)30-18-10-8-7-9-15-13-29-23(34)16(15)11-19(26(37)38-6)31-24(35)22-21-17(28(21,4)5)14-32(22)25(18)36/h15-19,21-22H,7-14H2,1-6H3,(H,29,34)(H,30,33)(H,31,35)/t15-,16-,17-,18-,19-,21-,22-/m0/s1 |
| InChIKey | DTQJPXVOWCLMLS-UMWWKMARSA-N |
| XLogP | 1.37 |
| TPSA | 133.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |