About octyl prop-2-enoate
octyl prop-2-enoate (PubChem CID 17258) has the molecular formula C11H20O2
and a molecular weight of 184.28 g/mol. Its IUPAC name is octyl prop-2-enoate.
Molecular Properties
| Compound Name | octyl prop-2-enoate |
| PubChem CID | 17258 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | octyl prop-2-enoate |
| SMILES | C=CC(=O)OCCCCCCCC |
| InChI | InChI=1S/C11H20O2/c1-3-5-6-7-8-9-10-13-11(12)4-2/h4H,2-3,5-10H2,1H3 |
| InChIKey | ANISOHQJBAQUQP-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze octyl prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octyl prop-2-enoate?
The IUPAC name of octyl prop-2-enoate (CID 17258) is octyl prop-2-enoate.
What is the SMILES notation for octyl prop-2-enoate?
The canonical SMILES for octyl prop-2-enoate is C=CC(=O)OCCCCCCCC.
What is the InChIKey of octyl prop-2-enoate?
The InChIKey is ANISOHQJBAQUQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H20O2/c1-3-5-6-7-8-9-10-13-11(12)4-2/h4H,2-3,5-10H2,1H3.
What are the key properties of octyl prop-2-enoate?
octyl prop-2-enoate has a molecular weight of 184.28 g/mol, XLogP of 3.08, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for octyl prop-2-enoate is sourced from PubChem (CID 17258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).