C17H21N2O6P — CID 172580446
1-[4-(1,5-dihydro-2,4,3-benzodioxaphosphepin-3-yloxy)-3-methoxybutyl]pyrimidine-2,4-dione (PubChem CID 172580446) has the molecular formula C17H21N2O6P and a molecular weight of 380.34 g/mol. Its IUPAC name is 1-[4-(1,5-dihydro-2,4,3-benzodioxaphosphepin-3-yloxy)-3-methoxybutyl]pyrimidine-2,4-dione.
| Compound Name | 1-[4-(1,5-dihydro-2,4,3-benzodioxaphosphepin-3-yloxy)-3-methoxybutyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 172580446 |
| Molecular Formula | C17H21N2O6P |
| Molecular Weight | 380.34 g/mol |
| Exact Mass | 380.11 |
| IUPAC Name | 1-[4-(1,5-dihydro-2,4,3-benzodioxaphosphepin-3-yloxy)-3-methoxybutyl]pyrimidine-2,4-dione |
| SMILES | COC(CCn1ccc(=O)[nH]c1=O)COP1OCc2ccccc2CO1 |
| InChI | InChI=1S/C17H21N2O6P/c1-22-15(6-8-19-9-7-16(20)18-17(19)21)12-25-26-23-10-13-4-2-3-5-14(13)11-24-26/h2-5,7,9,15H,6,8,10-12H2,1H3,(H,18,20,21) |
| InChIKey | BDJMEBWSUGUHOE-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|