C17H18FN3O2 — CID 172582045
methyl 4-[(6-cyano-4-fluorobenzimidazol-1-yl)methyl]cyclohexane-1-carboxylate (PubChem CID 172582045) has the molecular formula C17H18FN3O2 and a molecular weight of 315.35 g/mol. Its IUPAC name is methyl 4-[(6-cyano-4-fluorobenzimidazol-1-yl)methyl]cyclohexane-1-carboxylate.
| Compound Name | methyl 4-[(6-cyano-4-fluorobenzimidazol-1-yl)methyl]cyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 172582045 |
| Molecular Formula | C17H18FN3O2 |
| Molecular Weight | 315.35 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | methyl 4-[(6-cyano-4-fluorobenzimidazol-1-yl)methyl]cyclohexane-1-carboxylate |
| SMILES | COC(=O)C1CCC(Cn2cnc3c(F)cc(C#N)cc32)CC1 |
| InChI | InChI=1S/C17H18FN3O2/c1-23-17(22)13-4-2-11(3-5-13)9-21-10-20-16-14(18)6-12(8-19)7-15(16)21/h6-7,10-11,13H,2-5,9H2,1H3 |
| InChIKey | VWIOXFDCYNAYRA-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.35 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |