C19H18F2N4OS — CID 172582384
1-[6-[6-amino-5-(ethyliminomethyl)-3-pyridinyl]thieno[2,3-b]pyridin-2-yl]-3,3-difluorocyclobutan-1-ol (PubChem CID 172582384) has the molecular formula C19H18F2N4OS and a molecular weight of 388.44 g/mol. Its IUPAC name is 1-[6-[6-amino-5-(ethyliminomethyl)-3-pyridinyl]thieno[2,3-b]pyridin-2-yl]-3,3-difluorocyclobutan-1-ol.
| Compound Name | 1-[6-[6-amino-5-(ethyliminomethyl)-3-pyridinyl]thieno[2,3-b]pyridin-2-yl]-3,3-difluorocyclobutan-1-ol |
|---|---|
| PubChem CID | 172582384 |
| Molecular Formula | C19H18F2N4OS |
| Molecular Weight | 388.44 g/mol |
| Exact Mass | 388.12 |
| IUPAC Name | 1-[6-[6-amino-5-(ethyliminomethyl)-3-pyridinyl]thieno[2,3-b]pyridin-2-yl]-3,3-difluorocyclobutan-1-ol |
| SMILES | CC/N=C/c1cc(-c2ccc3cc(C4(O)CC(F)(F)C4)sc3n2)cnc1N |
| InChI | InChI=1S/C19H18F2N4OS/c1-2-23-7-13-5-12(8-24-16(13)22)14-4-3-11-6-15(27-17(11)25-14)18(26)9-19(20,21)10-18/h3-8,26H,2,9-10H2,1H3,(H2,22,24)/b23-7+ |
| InChIKey | AKOTWDIAYNTGGR-HCGXMYGOSA-N |
| XLogP | 4.00 |
| TPSA | 84.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.44 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|