C17H13F3IN6O2S- — CID 172582755
1-[5-(3-methyliodanuidyltriazolo[4,5-b]pyridin-6-yl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(trifluoromethoxy)cyclobutan-1-ol (PubChem CID 172582755) has the molecular formula C17H13F3IN6O2S- and a molecular weight of 549.30 g/mol. Its IUPAC name is 1-[5-(3-methyliodanuidyltriazolo[4,5-b]pyridin-6-yl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(trifluoromethoxy)cyclobutan-1-ol.
| Compound Name | 1-[5-(3-methyliodanuidyltriazolo[4,5-b]pyridin-6-yl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(trifluoromethoxy)cyclobutan-1-ol |
|---|---|
| PubChem CID | 172582755 |
| Molecular Formula | C17H13F3IN6O2S- |
| Molecular Weight | 549.30 g/mol |
| Exact Mass | 548.98 |
| IUPAC Name | 1-[5-(3-methyliodanuidyltriazolo[4,5-b]pyridin-6-yl)-[1,3]thiazolo[5,4-b]pyridin-2-yl]-3-(trifluoromethoxy)cyclobutan-1-ol |
| SMILES | C[I-]n1nnc2cc(-c3ccc4nc(C5(O)CC(OC(F)(F)F)C5)sc4n3)cnc21 |
| InChI | InChI=1S/C17H13F3IN6O2S/c1-21-27-13-12(25-26-27)4-8(7-22-13)10-2-3-11-14(23-10)30-15(24-11)16(28)5-9(6-16)29-17(18,19)20/h2-4,7,9,28H,5-6H2,1H3/q-1 |
| InChIKey | SYCVQSNOLCSGHH-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 98.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|