About ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine
ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine (PubChem CID 172584042) has the molecular formula C11H18N2O
and a molecular weight of 194.28 g/mol. Its IUPAC name is ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine |
| PubChem CID | 172584042 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine |
| SMILES | CC.CCc1nc(C)c2c(n1)OCC2 |
| InChI | InChI=1S/C9H12N2O.C2H6/c1-3-8-10-6(2)7-4-5-12-9(7)11-8;1-2/h3-5H2,1-2H3;1-2H3 |
| InChIKey | OZBZFLDSNCVVQG-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
The IUPAC name of ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine (CID 172584042) is ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine.
What is the SMILES notation for ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
The canonical SMILES for ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine is CC.CCc1nc(C)c2c(n1)OCC2.
What is the InChIKey of ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
The InChIKey is OZBZFLDSNCVVQG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O.C2H6/c1-3-8-10-6(2)7-4-5-12-9(7)11-8;1-2/h3-5H2,1-2H3;1-2H3.
What are the key properties of ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine?
ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine has a molecular weight of 194.28 g/mol, XLogP of 2.31, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-ethyl-4-methyl-5,6-dihydrofuro[2,3-d]pyrimidine is sourced from PubChem (CID 172584042), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).