C9H9B3N2O — CID 172585551
CID 172585551 (PubChem CID 172585551) has the molecular formula C9H9B3N2O and a molecular weight of 193.62 g/mol.
| Compound Name | CID 172585551 |
|---|---|
| PubChem CID | 172585551 |
| Molecular Formula | C9H9B3N2O |
| Molecular Weight | 193.62 g/mol |
| Exact Mass | 194.10 |
| IUPAC Name | — |
| SMILES | [B]C([B])([B])Oc1ncnc(C2CC2)c1C |
| InChI | InChI=1S/C9H9B3N2O/c1-5-7(6-2-3-6)13-4-14-8(5)15-9(10,11)12/h4,6H,2-3H2,1H3 |
| InChIKey | PFXMXXVJWIZGOK-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.62 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|